C13H20ClN5O3S — CID 25231313
[(2S,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-dimethylsulfanium chloride (PubChem CID 25231313) has the molecular formula C13H20ClN5O3S and a molecular weight of 361.86 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-dimethylsulfanium chloride.
| Compound Name | [(2S,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-dimethylsulfanium chloride |
|---|---|
| PubChem CID | 25231313 |
| Molecular Formula | C13H20ClN5O3S |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-dimethylsulfanium chloride |
| SMILES | Cc1nc2c(N)ncnc2n1[C@@H]1O[C@H](C[S+](C)C)[C@@H](O)[C@H]1O.[Cl-] |
| InChI | InChI=1S/C13H20N5O3S.ClH/c1-6-17-8-11(14)15-5-16-12(8)18(6)13-10(20)9(19)7(21-13)4-22(2)3;/h5,7,9-10,13,19-20H,4H2,1-3H3,(H2,14,15,16);1H/q+1;/p-1/t7-,9-,10-,13-;/m1./s1 |
| InChIKey | FBACGEDKRWBDKI-AZUPYXJKSA-M |
| XLogP | -3.78 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|