C17H20N6O3 — CID 66855798
(2R,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-(methylaminomethyl)oxolane-3,4-diol (PubChem CID 66855798) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is (2R,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-(methylaminomethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-(methylaminomethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 66855798 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2R,5R)-2-(6-amino-8-phenylpurin-9-yl)-5-(methylaminomethyl)oxolane-3,4-diol |
| SMILES | CNC[C@H]1O[C@@H](n2c(-c3ccccc3)nc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C17H20N6O3/c1-19-7-10-12(24)13(25)17(26-10)23-15(9-5-3-2-4-6-9)22-11-14(18)20-8-21-16(11)23/h2-6,8,10,12-13,17,19,24-25H,7H2,1H3,(H2,18,20,21)/t10-,12?,13?,17-/m1/s1 |
| InChIKey | ITCIQRQBKUJDSH-PTYRAISJSA-N |
| XLogP | -0.09 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |