C14H21N7O4 — CID 87180592
N-[[[(2R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]methyl]formamide (PubChem CID 87180592) has the molecular formula C14H21N7O4 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-[[[(2R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]methyl]formamide.
| Compound Name | N-[[[(2R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]methyl]formamide |
|---|---|
| PubChem CID | 87180592 |
| Molecular Formula | C14H21N7O4 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[[[(2R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]methyl]formamide |
| SMILES | Cc1nc2c(N)ncnc2n1[C@@H]1O[C@H](CN(C)CNC=O)C(O)C1O |
| InChI | InChI=1S/C14H21N7O4/c1-7-19-9-12(15)17-4-18-13(9)21(7)14-11(24)10(23)8(25-14)3-20(2)5-16-6-22/h4,6,8,10-11,14,23-24H,3,5H2,1-2H3,(H,16,22)(H2,15,17,18)/t8-,10?,11?,14-/m1/s1 |
| InChIKey | QZXQSBQKFQQBJI-BUTJNPDOSA-N |
| XLogP | -2.03 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|