C15H22N4O2 — CID 59892718
(2R,5R)-2-(6,8-dimethylpurin-9-yl)-4,5-diethyloxolan-3-ol (PubChem CID 59892718) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (2R,5R)-2-(6,8-dimethylpurin-9-yl)-4,5-diethyloxolan-3-ol.
| Compound Name | (2R,5R)-2-(6,8-dimethylpurin-9-yl)-4,5-diethyloxolan-3-ol |
|---|---|
| PubChem CID | 59892718 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (2R,5R)-2-(6,8-dimethylpurin-9-yl)-4,5-diethyloxolan-3-ol |
| SMILES | CCC1C(O)[C@H](n2c(C)nc3c(C)ncnc32)O[C@@H]1CC |
| InChI | InChI=1S/C15H22N4O2/c1-5-10-11(6-2)21-15(13(10)20)19-9(4)18-12-8(3)16-7-17-14(12)19/h7,10-11,13,15,20H,5-6H2,1-4H3/t10?,11-,13?,15-/m1/s1 |
| InChIKey | JXBYEOBDUUHSOO-WGJVFSFXSA-N |
| XLogP | 2.14 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |