C13H18N4O2 — CID 167678513
9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-6,8-dimethylpurine (PubChem CID 167678513) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-6,8-dimethylpurine.
| Compound Name | 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-6,8-dimethylpurine |
|---|---|
| PubChem CID | 167678513 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-6,8-dimethylpurine |
| SMILES | COC[C@@H]1CC[C@H](n2c(C)nc3c(C)ncnc32)O1 |
| InChI | InChI=1S/C13H18N4O2/c1-8-12-13(15-7-14-8)17(9(2)16-12)11-5-4-10(19-11)6-18-3/h7,10-11H,4-6H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | PGVCQSDMPHXDSX-WDEREUQCSA-N |
| XLogP | 1.77 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |