C21H29N7O8S-2 — CID 25181737
(2S,3R,4S,5S)-2-[(6-amino-8-phenylpurin-9-yl)methyl]-5-[hydroxy-[3-(methylamino)propylamino]methyl]oxolane-3,4-diol sulfate (PubChem CID 25181737) has the molecular formula C21H29N7O8S-2 and a molecular weight of 539.57 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[(6-amino-8-phenylpurin-9-yl)methyl]-5-[hydroxy-[3-(methylamino)propylamino]methyl]oxolane-3,4-diol sulfate.
| Compound Name | (2S,3R,4S,5S)-2-[(6-amino-8-phenylpurin-9-yl)methyl]-5-[hydroxy-[3-(methylamino)propylamino]methyl]oxolane-3,4-diol sulfate |
|---|---|
| PubChem CID | 25181737 |
| Molecular Formula | C21H29N7O8S-2 |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | (2S,3R,4S,5S)-2-[(6-amino-8-phenylpurin-9-yl)methyl]-5-[hydroxy-[3-(methylamino)propylamino]methyl]oxolane-3,4-diol sulfate |
| SMILES | CNCCCNC(O)[C@H]1O[C@@H](Cn2c(-c3ccccc3)nc3c(N)ncnc32)[C@H](O)[C@@H]1O.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C21H29N7O4.H2O4S/c1-23-8-5-9-24-21(31)17-16(30)15(29)13(32-17)10-28-19(12-6-3-2-4-7-12)27-14-18(22)25-11-26-20(14)28;1-5(2,3)4/h2-4,6-7,11,13,15-17,21,23-24,29-31H,5,8-10H2,1H3,(H2,22,25,26);(H2,1,2,3,4)/p-2/t13-,15-,16-,17-,21?;/m0./s1 |
| InChIKey | PUTRJDTXCBIKTL-OHRDWXRTSA-L |
| XLogP | -2.26 |
| TPSA | 243.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|