C18H22N5NaO7PS+ — CID 162294335
sodium;9-[(4aR,6R,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(3-methoxyphenyl)sulfanylpurin-6-amine;hydride (PubChem CID 162294335) has the molecular formula C18H22N5NaO7PS+ and a molecular weight of 506.43 g/mol. Its IUPAC name is sodium;9-[(4aR,6R,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(3-methoxyphenyl)sulfanylpurin-6-amine;hydride.
| Compound Name | sodium;9-[(4aR,6R,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(3-methoxyphenyl)sulfanylpurin-6-amine;hydride |
|---|---|
| PubChem CID | 162294335 |
| Molecular Formula | C18H22N5NaO7PS+ |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | sodium;9-[(4aR,6R,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-(3-methoxyphenyl)sulfanylpurin-6-amine;hydride |
| SMILES | COc1cccc(Sc2nc3c(N)ncnc3n2[C@@H]2O[C@@H]3CO[P+](O)(O)O[C@H]3C2OC)c1.[H-].[Na+] |
| InChI | InChI=1S/C18H21N5O7PS.Na.H/c1-26-9-4-3-5-10(6-9)32-18-22-12-15(19)20-8-21-16(12)23(18)17-14(27-2)13-11(29-17)7-28-31(24,25)30-13;;/h3-6,8,11,13-14,17,24-25H,7H2,1-2H3,(H2,19,20,21);;/q2*+1;-1/t11-,13-,14?,17-;;/m1../s1 |
| InChIKey | HLTVDFPIVKMUTA-OHHBVWAESA-N |
| XLogP | -1.33 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|