C22H19BClN5O5PS+ — CID 90088761
CID 90088761 (PubChem CID 90088761) has the molecular formula C22H19BClN5O5PS+ and a molecular weight of 542.73 g/mol.
| Compound Name | CID 90088761 |
|---|---|
| PubChem CID | 90088761 |
| Molecular Formula | C22H19BClN5O5PS+ |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | — |
| SMILES | [B][P+]1(O)OC[C@H]2O[C@@H](n3c(Sc4ccc(Cl)cc4)nc4c(Nc5ccccc5)ncnc43)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C22H19BClN5O5PS/c23-35(31)32-10-15-18(34-35)17(30)21(33-15)29-20-16(28-22(29)36-14-8-6-12(24)7-9-14)19(25-11-26-20)27-13-4-2-1-3-5-13/h1-9,11,15,17-18,21,30-31H,10H2,(H,25,26,27)/q+1/t15-,17+,18+,21-,35?/m1/s1 |
| InChIKey | WRXFAHGWMVICMJ-ATTZLWPXSA-N |
| XLogP | 3.89 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|