C16H14ClN5O7PS+ — CID 174029189
9-[(6R,7aS)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-amino-8-(4-chlorophenyl)sulfinyl-1H-purin-6-one (PubChem CID 174029189) has the molecular formula C16H14ClN5O7PS+ and a molecular weight of 486.81 g/mol. Its IUPAC name is 9-[(6R,7aS)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-amino-8-(4-chlorophenyl)sulfinyl-1H-purin-6-one.
| Compound Name | 9-[(6R,7aS)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-amino-8-(4-chlorophenyl)sulfinyl-1H-purin-6-one |
|---|---|
| PubChem CID | 174029189 |
| Molecular Formula | C16H14ClN5O7PS+ |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 9-[(6R,7aS)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-2-amino-8-(4-chlorophenyl)sulfinyl-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(S(=O)c3ccc(Cl)cc3)n2[C@@H]2OC3CO[P+](=O)O[C@H]3C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H13ClN5O7PS/c17-6-1-3-7(4-2-6)31(26)16-19-9-12(20-15(18)21-13(9)24)22(16)14-10(23)11-8(28-14)5-27-30(25)29-11/h1-4,8,10-11,14,23H,5H2,(H2-,18,20,21,24)/p+1/t8?,10?,11-,14-,31?/m1/s1 |
| InChIKey | DBQCQGKGZWRZKJ-WLSOQXBPSA-O |
| XLogP | 0.85 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|