C18H24N5O9P — CID 136511192
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(4-ethylphenyl)-1H-purin-6-one;phosphoric acid (PubChem CID 136511192) has the molecular formula C18H24N5O9P and a molecular weight of 485.39 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(4-ethylphenyl)-1H-purin-6-one;phosphoric acid.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(4-ethylphenyl)-1H-purin-6-one;phosphoric acid |
|---|---|
| PubChem CID | 136511192 |
| Molecular Formula | C18H24N5O9P |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-(4-ethylphenyl)-1H-purin-6-one;phosphoric acid |
| SMILES | CCc1ccc(-c2nc3c(=O)[nH]c(N)nc3n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C18H21N5O5.H3O4P/c1-2-8-3-5-9(6-4-8)14-20-11-15(21-18(19)22-16(11)27)23(14)17-13(26)12(25)10(7-24)28-17;1-5(2,3)4/h3-6,10,12-13,17,24-26H,2,7H2,1H3,(H3,19,21,22,27);(H3,1,2,3,4)/t10-,12-,13-,17-;/m1./s1 |
| InChIKey | UVHFUTCRNPQIJC-FKVBDRBCSA-N |
| XLogP | -1.39 |
| TPSA | 237.27 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|