C16H24IN4O4P — CID 158541198
9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-iodo-2-methyl-1H-purin-6-one (PubChem CID 158541198) has the molecular formula C16H24IN4O4P and a molecular weight of 494.27 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-iodo-2-methyl-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-iodo-2-methyl-1H-purin-6-one |
|---|---|
| PubChem CID | 158541198 |
| Molecular Formula | C16H24IN4O4P |
| Molecular Weight | 494.27 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-3,4-dihydroxyoxolan-2-yl]-8-iodo-2-methyl-1H-purin-6-one |
| SMILES | C=P(C)(C)CC(C)[C@H]1O[C@@H](n2c(I)nc3c(=O)[nH]c(C)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H24IN4O4P/c1-7(6-26(3,4)5)12-10(22)11(23)15(25-12)21-13-9(20-16(21)17)14(24)19-8(2)18-13/h7,10-12,15,22-23H,3,6H2,1-2,4-5H3,(H,18,19,24)/t7?,10-,11+,12+,15+/m0/s1 |
| InChIKey | YRPGDPZBHKLAEO-UAWNNTJMSA-N |
| XLogP | 1.00 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|