C16H24ClN4O3P — CID 162077375
9-[(2R,3R,4R,5R)-3-chloro-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-4-hydroxyoxolan-2-yl]-2-methyl-1H-purin-6-one (PubChem CID 162077375) has the molecular formula C16H24ClN4O3P and a molecular weight of 386.82 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3-chloro-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-4-hydroxyoxolan-2-yl]-2-methyl-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4R,5R)-3-chloro-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-4-hydroxyoxolan-2-yl]-2-methyl-1H-purin-6-one |
|---|---|
| PubChem CID | 162077375 |
| Molecular Formula | C16H24ClN4O3P |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3-chloro-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]-4-hydroxyoxolan-2-yl]-2-methyl-1H-purin-6-one |
| SMILES | C=P(C)(C)CC(C)[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(C)nc32)[C@H](Cl)[C@@H]1O |
| InChI | InChI=1S/C16H24ClN4O3P/c1-8(6-25(3,4)5)13-12(22)10(17)16(24-13)21-7-18-11-14(21)19-9(2)20-15(11)23/h7-8,10,12-13,16,22H,3,6H2,1-2,4-5H3,(H,19,20,23)/t8?,10-,12+,13-,16-/m1/s1 |
| InChIKey | OWTWSKOSXMRWTH-AKHDXOTNSA-N |
| XLogP | 1.64 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|