C12H16B4N4O5 — CID 167637273
CID 167637273 (PubChem CID 167637273) has the molecular formula C12H16B4N4O5 and a molecular weight of 339.53 g/mol.
| Compound Name | CID 167637273 |
|---|---|
| PubChem CID | 167637273 |
| Molecular Formula | C12H16B4N4O5 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1C(O)[C@H](n2cnc3c(=O)[nH]c(C)nc32)O[C@@H]1CO.[B]B([B])[B] |
| InChI | InChI=1S/C12H16N4O5.B4/c1-5-14-10-7(11(19)15-5)13-4-16(10)12-8(18)9(20-2)6(3-17)21-12;1-4(2)3/h4,6,8-9,12,17-18H,3H2,1-2H3,(H,14,15,19);/t6-,8?,9+,12-;/m1./s1 |
| InChIKey | CLZHGTOJKCWEOS-AHBUDECNSA-N |
| XLogP | -2.83 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|