C18H29N4O3P — CID 159526008
(2R,3R,4S,5R)-2-(7-amino-2-ethylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol (PubChem CID 159526008) has the molecular formula C18H29N4O3P and a molecular weight of 380.43 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(7-amino-2-ethylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(7-amino-2-ethylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 159526008 |
| Molecular Formula | C18H29N4O3P |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-(7-amino-2-ethylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol |
| SMILES | C=P(C)(C)CC(C)[C@H]1O[C@@H](n2c(CC)nc3c(N)ccnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H29N4O3P/c1-6-12-21-13-11(19)7-8-20-17(13)22(12)18-15(24)14(23)16(25-18)10(2)9-26(3,4)5/h7-8,10,14-16,18,23-24H,3,6,9H2,1-2,4-5H3,(H2,19,20)/t10?,14-,15+,16+,18+/m0/s1 |
| InChIKey | FWNSCBZJXJNIEY-HJGREZGXSA-N |
| XLogP | 1.54 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|