C17H27N4O3PS — CID 162201834
(2R,3R,4S,5R)-2-(7-amino-2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol (PubChem CID 162201834) has the molecular formula C17H27N4O3PS and a molecular weight of 398.47 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(7-amino-2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(7-amino-2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 162201834 |
| Molecular Formula | C17H27N4O3PS |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-(7-amino-2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[1-[dimethyl(methylidene)-λ5-phosphanyl]propan-2-yl]oxolane-3,4-diol |
| SMILES | C=P(C)(C)CC(C)[C@H]1O[C@@H](n2c(SC)nc3c(N)ccnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H27N4O3PS/c1-9(8-25(2,3)4)14-12(22)13(23)16(24-14)21-15-11(20-17(21)26-5)10(18)6-7-19-15/h6-7,9,12-14,16,22-23H,2,8H2,1,3-5H3,(H2,18,19)/t9?,12-,13+,14+,16+/m0/s1 |
| InChIKey | XOZKRDZKUDZQQN-UDWKWMFFSA-N |
| XLogP | 1.70 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|