C10H13FN2O6 — CID 140532598
6-fluoro-5-methyl-3-[(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 140532598) has the molecular formula C10H13FN2O6 and a molecular weight of 276.22 g/mol. Its IUPAC name is 6-fluoro-5-methyl-3-[(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-fluoro-5-methyl-3-[(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140532598 |
| Molecular Formula | C10H13FN2O6 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 6-fluoro-5-methyl-3-[(3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1c(F)[nH]c(=O)n(C2OC[C@@H](O)[C@@H](O)[C@@H]2O)c1=O |
| InChI | InChI=1S/C10H13FN2O6/c1-3-7(11)12-10(18)13(8(3)17)9-6(16)5(15)4(14)2-19-9/h4-6,9,14-16H,2H2,1H3,(H,12,18)/t4-,5-,6+,9?/m1/s1 |
| InChIKey | DOFKRBOLQUBNJZ-ZBLRDTDUSA-N |
| XLogP | -2.40 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |