C18H29N2O4P — CID 90275943
5-[(E)-but-1-enyl]-1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one (PubChem CID 90275943) has the molecular formula C18H29N2O4P and a molecular weight of 368.41 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one.
| Compound Name | 5-[(E)-but-1-enyl]-1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 90275943 |
| Molecular Formula | C18H29N2O4P |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 5-[(E)-but-1-enyl]-1-[(2R,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-2-methylidenepyrimidin-4-one |
| SMILES | C=C1NC(=O)C(/C=C/CC)=CN1[C@@H]1O[C@H](CCP(=C)(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H29N2O4P/c1-6-7-8-13-11-20(12(2)19-17(13)23)18-16(22)15(21)14(24-18)9-10-25(3,4)5/h7-8,11,14-16,18,21-22H,2-3,6,9-10H2,1,4-5H3,(H,19,23)/b8-7+/t14-,15-,16-,18-/m1/s1 |
| InChIKey | RMCAUBKCTBANHV-TVJHRVJGSA-N |
| XLogP | 1.29 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|