C18H30N5O4P — CID 136509473
2-(butylamino)-9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 136509473) has the molecular formula C18H30N5O4P and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-(butylamino)-9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(butylamino)-9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136509473 |
| Molecular Formula | C18H30N5O4P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-(butylamino)-9-[(2R,3R,4S)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | C=P(C)(C)CCC1O[C@@H](n2cnc3c(=O)[nH]c(NCCCC)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H30N5O4P/c1-5-6-8-19-18-21-15-12(16(26)22-18)20-10-23(15)17-14(25)13(24)11(27-17)7-9-28(2,3)4/h10-11,13-14,17,24-25H,2,5-9H2,1,3-4H3,(H2,19,21,22,26)/t11?,13-,14-,17-/m1/s1 |
| InChIKey | DGLHXJVNJRWHBZ-LZLKQYFISA-N |
| XLogP | 1.05 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|