C15H21N5O6 — CID 46876688
6-(butylamino)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione (PubChem CID 46876688) has the molecular formula C15H21N5O6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 6-(butylamino)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione.
| Compound Name | 6-(butylamino)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
|---|---|
| PubChem CID | 46876688 |
| Molecular Formula | C15H21N5O6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 6-(butylamino)-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
| SMILES | CCCCNc1nc(=O)c2ncn(C3O[C@H](CO)[C@@H](O)[C@H]3O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C15H21N5O6/c1-2-3-4-16-15-18-12(24)8-9(13(25)19-15)20(6-17-8)14-11(23)10(22)7(5-21)26-14/h6-7,10-11,14,21-23H,2-5H2,1H3,(H2,16,18,19,24,25)/t7-,10-,11-,14?/m1/s1 |
| InChIKey | MNJITHVXJQFBTI-WHXREITPSA-N |
| XLogP | -1.70 |
| TPSA | 162.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|