C17H25N5O6 — CID 46876689
1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(hexylamino)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione (PubChem CID 46876689) has the molecular formula C17H25N5O6 and a molecular weight of 395.42 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(hexylamino)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione.
| Compound Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(hexylamino)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
|---|---|
| PubChem CID | 46876689 |
| Molecular Formula | C17H25N5O6 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(hexylamino)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
| SMILES | CCCCCCNc1nc(=O)c2ncn(C3O[C@H](CO)[C@@H](O)[C@H]3O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H25N5O6/c1-2-3-4-5-6-18-17-20-14(26)10-11(15(27)21-17)22(8-19-10)16-13(25)12(24)9(7-23)28-16/h8-9,12-13,16,23-25H,2-7H2,1H3,(H2,18,20,21,26,27)/t9-,12-,13-,16?/m1/s1 |
| InChIKey | HDUFLGXBVRHKSW-VTRSQVMYSA-N |
| XLogP | -0.92 |
| TPSA | 162.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|