C20H23N6O5PS4 — CID 166881192
2-amino-9-[(2S,6R,7aS)-2-[(4R,5R)-5-(pyridin-4-ylmethoxy)dithian-4-yl]oxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3H-purine-6-thione (PubChem CID 166881192) has the molecular formula C20H23N6O5PS4 and a molecular weight of 586.68 g/mol. Its IUPAC name is 2-amino-9-[(2S,6R,7aS)-2-[(4R,5R)-5-(pyridin-4-ylmethoxy)dithian-4-yl]oxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3H-purine-6-thione.
| Compound Name | 2-amino-9-[(2S,6R,7aS)-2-[(4R,5R)-5-(pyridin-4-ylmethoxy)dithian-4-yl]oxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 166881192 |
| Molecular Formula | C20H23N6O5PS4 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | 2-amino-9-[(2S,6R,7aS)-2-[(4R,5R)-5-(pyridin-4-ylmethoxy)dithian-4-yl]oxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3H-purine-6-thione |
| SMILES | Nc1nc(=S)c2ncn([C@H]3C[C@@H]4O[P@](=S)(O[C@H]5CSSC[C@@H]5OCc5ccncc5)OCC4O3)c2[nH]1 |
| InChI | InChI=1S/C20H23N6O5PS4/c21-20-24-18-17(19(33)25-20)23-10-26(18)16-5-12-13(29-16)7-28-32(34,30-12)31-15-9-36-35-8-14(15)27-6-11-1-3-22-4-2-11/h1-4,10,12-16H,5-9H2,(H3,21,24,25,33)/t12-,13?,14-,15-,16+,32-/m0/s1 |
| InChIKey | WAPADYNQPIGNCC-SZAZJCAKSA-N |
| XLogP | 3.76 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|