C16H22N5O5PS5 — CID 155033887
[(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl bis(dithiolan-4-yl) phosphate (PubChem CID 155033887) has the molecular formula C16H22N5O5PS5 and a molecular weight of 555.69 g/mol. Its IUPAC name is [(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl bis(dithiolan-4-yl) phosphate.
| Compound Name | [(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl bis(dithiolan-4-yl) phosphate |
|---|---|
| PubChem CID | 155033887 |
| Molecular Formula | C16H22N5O5PS5 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | [(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl bis(dithiolan-4-yl) phosphate |
| SMILES | Nc1nc(=S)c2ncn([C@H]3CC[C@@H](COP(=O)(OC4CSSC4)OC4CSSC4)O3)c2[nH]1 |
| InChI | InChI=1S/C16H22N5O5PS5/c17-16-19-14-13(15(28)20-16)18-8-21(14)12-2-1-9(24-12)3-23-27(22,25-10-4-29-30-5-10)26-11-6-31-32-7-11/h8-12H,1-7H2,(H3,17,19,20,28)/t9-,12+/m0/s1 |
| InChIKey | GYZZGLHLLQOXHT-JOYOIKCWSA-N |
| XLogP | 4.43 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|