C10H6N8O2S2 — CID 57006875
9-(6-oxo-2-sulfanylidene-3H-purin-9-yl)-2-sulfanylidene-3H-purin-6-one (PubChem CID 57006875) has the molecular formula C10H6N8O2S2 and a molecular weight of 334.35 g/mol. Its IUPAC name is 9-(6-oxo-2-sulfanylidene-3H-purin-9-yl)-2-sulfanylidene-3H-purin-6-one.
| Compound Name | 9-(6-oxo-2-sulfanylidene-3H-purin-9-yl)-2-sulfanylidene-3H-purin-6-one |
|---|---|
| PubChem CID | 57006875 |
| Molecular Formula | C10H6N8O2S2 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 9-(6-oxo-2-sulfanylidene-3H-purin-9-yl)-2-sulfanylidene-3H-purin-6-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1ncn2-n1cnc2c(=O)[nH]c(=S)[nH]c21 |
| InChI | InChI=1S/C10H6N8O2S2/c19-7-3-5(13-9(21)15-7)17(1-11-3)18-2-12-4-6(18)14-10(22)16-8(4)20/h1-2H,(H2,13,15,19,21)(H2,14,16,20,22) |
| InChIKey | FXRBRWMVQWWBPL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|