C13H21N5O6P2 — CID 88502631
CID 88502631 (PubChem CID 88502631) has the molecular formula C13H21N5O6P2 and a molecular weight of 405.29 g/mol.
| Compound Name | CID 88502631 |
|---|---|
| PubChem CID | 88502631 |
| Molecular Formula | C13H21N5O6P2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(ncn2CCCCCCCO/[P+]([O-])=C/P(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H21N5O6P2/c14-13-16-11-10(12(19)17-13)15-8-18(11)6-4-2-1-3-5-7-24-25(20)9-26(21,22)23/h8-9H,1-7H2,(H2,21,22,23)(H3,14,16,17,19) |
| InChIKey | JUDPLZXARBZLHJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|