C11H18N6O2S — CID 135432866
2-amino-9-[5-(methylsulfonimidoyl)pentyl]-1H-purin-6-one (PubChem CID 135432866) has the molecular formula C11H18N6O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-amino-9-[5-(methylsulfonimidoyl)pentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[5-(methylsulfonimidoyl)pentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135432866 |
| Molecular Formula | C11H18N6O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-amino-9-[5-(methylsulfonimidoyl)pentyl]-1H-purin-6-one |
| SMILES | [H]N=S(C)(=O)CCCCCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H18N6O2S/c1-20(13,19)6-4-2-3-5-17-7-14-8-9(17)15-11(12)16-10(8)18/h7,13H,2-6H2,1H3,(H3,12,15,16,18) |
| InChIKey | JVELUTHVDHRFQF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|