C15H26N5O2Si — CID 69303040
CID 69303040 (PubChem CID 69303040) has the molecular formula C15H26N5O2Si and a molecular weight of 336.49 g/mol.
| Compound Name | CID 69303040 |
|---|---|
| PubChem CID | 69303040 |
| Molecular Formula | C15H26N5O2Si |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | — |
| SMILES | CCCCOC(C(O)CCn1cnc2c(N)ncnc21)[Si](C)C |
| InChI | InChI=1S/C15H26N5O2Si/c1-4-5-8-22-15(23(2)3)11(21)6-7-20-10-19-12-13(16)17-9-18-14(12)20/h9-11,15,21H,4-8H2,1-3H3,(H2,16,17,18) |
| InChIKey | BXGNLHBOFCQCSX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|