C26H29ClN5O6P — CID 11813841
[2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] acetate (PubChem CID 11813841) has the molecular formula C26H29ClN5O6P and a molecular weight of 573.97 g/mol. Its IUPAC name is [2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] acetate.
| Compound Name | [2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] acetate |
|---|---|
| PubChem CID | 11813841 |
| Molecular Formula | C26H29ClN5O6P |
| Molecular Weight | 573.97 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | [2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] acetate |
| SMILES | CNc1nc(Cl)nc2c1ncn2CC(COC(C)=O)COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H29ClN5O6P/c1-19(33)35-14-22(13-32-18-29-23-24(28-2)30-26(27)31-25(23)32)17-38-39(34,36-15-20-9-5-3-6-10-20)37-16-21-11-7-4-8-12-21/h3-12,18,22H,13-17H2,1-2H3,(H,28,30,31) |
| InChIKey | HQSFRUONEYGGRA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.97 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|