C29H35ClN5O6P — CID 10941123
[2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2,2-dimethylpropanoate (PubChem CID 10941123) has the molecular formula C29H35ClN5O6P and a molecular weight of 616.06 g/mol. Its IUPAC name is [2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10941123 |
| Molecular Formula | C29H35ClN5O6P |
| Molecular Weight | 616.06 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | [2-[bis(phenylmethoxy)phosphoryloxymethyl]-3-[2-chloro-6-(methylamino)purin-9-yl]propyl] 2,2-dimethylpropanoate |
| SMILES | CNc1nc(Cl)nc2c1ncn2CC(COC(=O)C(C)(C)C)COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H35ClN5O6P/c1-29(2,3)27(36)38-16-23(15-35-20-32-24-25(31-4)33-28(30)34-26(24)35)19-41-42(37,39-17-21-11-7-5-8-12-21)40-18-22-13-9-6-10-14-22/h5-14,20,23H,15-19H2,1-4H3,(H,31,33,34) |
| InChIKey | ZKYWKHZXSLPRKY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.06 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|