C24H29ClN5O11P3 — CID 11017907
dibenzyl [2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-[hydroxy(phosphonooxy)phosphoryl]oxypropyl] phosphate (PubChem CID 11017907) has the molecular formula C24H29ClN5O11P3 and a molecular weight of 691.90 g/mol. Its IUPAC name is dibenzyl [2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-[hydroxy(phosphonooxy)phosphoryl]oxypropyl] phosphate.
| Compound Name | dibenzyl [2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-[hydroxy(phosphonooxy)phosphoryl]oxypropyl] phosphate |
|---|---|
| PubChem CID | 11017907 |
| Molecular Formula | C24H29ClN5O11P3 |
| Molecular Weight | 691.90 g/mol |
| Exact Mass | 691.08 |
| IUPAC Name | dibenzyl [2-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-3-[hydroxy(phosphonooxy)phosphoryl]oxypropyl] phosphate |
| SMILES | CNc1nc(Cl)nc2c1ncn2CC(COP(=O)(O)OP(=O)(O)O)COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H29ClN5O11P3/c1-26-22-21-23(29-24(25)28-22)30(17-27-21)12-20(15-37-43(34,35)41-42(31,32)33)16-40-44(36,38-13-18-8-4-2-5-9-18)39-14-19-10-6-3-7-11-19/h2-11,17,20H,12-16H2,1H3,(H,34,35)(H,26,28,29)(H2,31,32,33) |
| InChIKey | KOHXSAVPBJBLSP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 213.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|