C7H4ClFN4O2 — CID 86049987
2-(6-chloro-2-fluoropurin-9-yl)acetic acid (PubChem CID 86049987) has the molecular formula C7H4ClFN4O2 and a molecular weight of 230.59 g/mol. Its IUPAC name is 2-(6-chloro-2-fluoropurin-9-yl)acetic acid.
| Compound Name | 2-(6-chloro-2-fluoropurin-9-yl)acetic acid |
|---|---|
| PubChem CID | 86049987 |
| Molecular Formula | C7H4ClFN4O2 |
| Molecular Weight | 230.59 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2-(6-chloro-2-fluoropurin-9-yl)acetic acid |
| SMILES | O=C(O)Cn1cnc2c(Cl)nc(F)nc21 |
| InChI | InChI=1S/C7H4ClFN4O2/c8-5-4-6(12-7(9)11-5)13(2-10-4)1-3(14)15/h2H,1H2,(H,14,15) |
| InChIKey | GIWYLLNDHFJQPI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.59 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |