C14H11Cl2N5O2S — CID 177001298
2-(2,6-dichloropurin-9-yl)-N-(4-methylsulfinylphenyl)acetamide (PubChem CID 177001298) has the molecular formula C14H11Cl2N5O2S and a molecular weight of 384.25 g/mol. Its IUPAC name is 2-(2,6-dichloropurin-9-yl)-N-(4-methylsulfinylphenyl)acetamide.
| Compound Name | 2-(2,6-dichloropurin-9-yl)-N-(4-methylsulfinylphenyl)acetamide |
|---|---|
| PubChem CID | 177001298 |
| Molecular Formula | C14H11Cl2N5O2S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 2-(2,6-dichloropurin-9-yl)-N-(4-methylsulfinylphenyl)acetamide |
| SMILES | CS(=O)c1ccc(NC(=O)Cn2cnc3c(Cl)nc(Cl)nc32)cc1 |
| InChI | InChI=1S/C14H11Cl2N5O2S/c1-24(23)9-4-2-8(3-5-9)18-10(22)6-21-7-17-11-12(15)19-14(16)20-13(11)21/h2-5,7H,6H2,1H3,(H,18,22) |
| InChIKey | KXZVOHOFOUDWNR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |