C6H3Cl2N3O5 — CID 16785690
2-(4,5-dichloro-3-nitro-6-oxopyridazin-1-yl)acetic acid (PubChem CID 16785690) has the molecular formula C6H3Cl2N3O5 and a molecular weight of 268.01 g/mol. Its IUPAC name is 2-(4,5-dichloro-3-nitro-6-oxopyridazin-1-yl)acetic acid.
| Compound Name | 2-(4,5-dichloro-3-nitro-6-oxopyridazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 16785690 |
| Molecular Formula | C6H3Cl2N3O5 |
| Molecular Weight | 268.01 g/mol |
| Exact Mass | 266.94 |
| IUPAC Name | 2-(4,5-dichloro-3-nitro-6-oxopyridazin-1-yl)acetic acid |
| SMILES | O=C(O)Cn1nc([N+](=O)[O-])c(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C6H3Cl2N3O5/c7-3-4(8)6(14)10(1-2(12)13)9-5(3)11(15)16/h1H2,(H,12,13) |
| InChIKey | LSNNDIPPSLEBQR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.01 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|