C7H6Cl2N4O4 — CID 14842399
4,5-dichloro-2-[(2E)-2-hydroxyiminopropyl]-6-nitropyridazin-3-one (PubChem CID 14842399) has the molecular formula C7H6Cl2N4O4 and a molecular weight of 281.06 g/mol. Its IUPAC name is 4,5-dichloro-2-[(2E)-2-hydroxyiminopropyl]-6-nitropyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[(2E)-2-hydroxyiminopropyl]-6-nitropyridazin-3-one |
|---|---|
| PubChem CID | 14842399 |
| Molecular Formula | C7H6Cl2N4O4 |
| Molecular Weight | 281.06 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 4,5-dichloro-2-[(2E)-2-hydroxyiminopropyl]-6-nitropyridazin-3-one |
| SMILES | C/C(Cn1nc([N+](=O)[O-])c(Cl)c(Cl)c1=O)=N\O |
| InChI | InChI=1S/C7H6Cl2N4O4/c1-3(11-15)2-12-7(14)5(9)4(8)6(10-12)13(16)17/h15H,2H2,1H3/b11-3+ |
| InChIKey | AZZRRIHAYKGFCF-QDEBKDIKSA-N |
| XLogP | 1.31 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.06 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|