C12H15ClN4O5 — CID 19529470
ethyl (E)-3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate (PubChem CID 19529470) has the molecular formula C12H15ClN4O5 and a molecular weight of 330.73 g/mol. Its IUPAC name is ethyl (E)-3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19529470 |
| Molecular Formula | C12H15ClN4O5 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | ethyl (E)-3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)Cn1nc([N+](=O)[O-])c(Cl)c1C |
| InChI | InChI=1S/C12H15ClN4O5/c1-4-22-10(19)5-7(2)14-9(18)6-16-8(3)11(13)12(15-16)17(20)21/h5H,4,6H2,1-3H3,(H,14,18)/b7-5+ |
| InChIKey | FIUZAPPGLSOLGO-FNORWQNLSA-N |
| XLogP | 1.34 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|