C15H18F3N3O3 — CID 19526296
ethyl (E)-3-[[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]but-2-enoate (PubChem CID 19526296) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is ethyl (E)-3-[[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19526296 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | ethyl (E)-3-[[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)Cn1nc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C15H18F3N3O3/c1-3-24-14(23)6-9(2)19-13(22)8-21-11(10-4-5-10)7-12(20-21)15(16,17)18/h6-7,10H,3-5,8H2,1-2H3,(H,19,22)/b9-6+ |
| InChIKey | WZFLMXDIWHJGHD-RMKNXTFCSA-N |
| XLogP | 2.36 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|