C16H15F4N3O — CID 843513
2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 843513) has the molecular formula C16H15F4N3O and a molecular weight of 341.31 g/mol. Its IUPAC name is 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 843513 |
| Molecular Formula | C16H15F4N3O |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15F4N3O/c17-12-5-1-10(2-6-12)8-21-15(24)9-23-13(11-3-4-11)7-14(22-23)16(18,19)20/h1-2,5-7,11H,3-4,8-9H2,(H,21,24) |
| InChIKey | DBISOQOAIHTZKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |