C17H18F4N4O — CID 17374525
1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)urea (PubChem CID 17374525) has the molecular formula C17H18F4N4O and a molecular weight of 370.35 g/mol. Its IUPAC name is 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 17374525 |
| Molecular Formula | C17H18F4N4O |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18F4N4O/c18-12-4-6-13(7-5-12)23-16(26)22-8-1-9-25-14(11-2-3-11)10-15(24-25)17(19,20)21/h4-7,10-11H,1-3,8-9H2,(H2,22,23,26) |
| InChIKey | KBRPJUHTSCGCET-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|