C18H21F3N4O2 — CID 121139775
1-[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-ethoxyphenyl)urea (PubChem CID 121139775) has the molecular formula C18H21F3N4O2 and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 121139775 |
| Molecular Formula | C18H21F3N4O2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCCn2nc(C(F)(F)F)cc2C2CC2)cc1 |
| InChI | InChI=1S/C18H21F3N4O2/c1-2-27-14-7-5-13(6-8-14)23-17(26)22-9-10-25-15(12-3-4-12)11-16(24-25)18(19,20)21/h5-8,11-12H,2-4,9-10H2,1H3,(H2,22,23,26) |
| InChIKey | PRTBNHTWPSTYTA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |