C18H29N3O2 — CID 769372
1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-3-(4-ethoxyphenyl)urea (PubChem CID 769372) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 769372 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 1-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCCN2[C@H](C)CCC[C@H]2C)cc1 |
| InChI | InChI=1S/C18H29N3O2/c1-4-23-17-10-8-16(9-11-17)20-18(22)19-12-13-21-14(2)6-5-7-15(21)3/h8-11,14-15H,4-7,12-13H2,1-3H3,(H2,19,20,22)/t14-,15-/m1/s1 |
| InChIKey | CEONUKADDXRNBN-HUUCEWRRSA-N |
| XLogP | 3.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |