C15H23F3N4O — CID 19334007
1-butyl-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]urea (PubChem CID 19334007) has the molecular formula C15H23F3N4O and a molecular weight of 332.37 g/mol. Its IUPAC name is 1-butyl-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]urea.
| Compound Name | 1-butyl-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]urea |
|---|---|
| PubChem CID | 19334007 |
| Molecular Formula | C15H23F3N4O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-butyl-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]urea |
| SMILES | CCCCNC(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C15H23F3N4O/c1-2-3-7-19-14(23)20-8-4-9-22-12(11-5-6-11)10-13(21-22)15(16,17)18/h10-11H,2-9H2,1H3,(H2,19,20,23) |
| InChIKey | SIXUHQBPPOJERJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|