C11H14N4O5 — CID 19521688
ethyl (E)-3-[[2-(3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate (PubChem CID 19521688) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is ethyl (E)-3-[[2-(3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[2-(3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19521688 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | ethyl (E)-3-[[2-(3-nitropyrazol-1-yl)acetyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H14N4O5/c1-3-20-11(17)6-8(2)12-10(16)7-14-5-4-9(13-14)15(18)19/h4-6H,3,7H2,1-2H3,(H,12,16)/b8-6+ |
| InChIKey | NJRMHYZUXAMYPI-SOFGYWHQSA-N |
| XLogP | 0.37 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|