C10H17N5O3 — CID 19521579
N-[3-(dimethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 19521579) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19521579 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | CN(C)CCCNC(=O)Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H17N5O3/c1-13(2)6-3-5-11-10(16)8-14-7-4-9(12-14)15(17)18/h4,7H,3,5-6,8H2,1-2H3,(H,11,16) |
| InChIKey | SCHUGFZRJNOROY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|