C10H16N4O4 — CID 115771713
N-ethyl-N-(3-hydroxypropyl)-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 115771713) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is N-ethyl-N-(3-hydroxypropyl)-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-ethyl-N-(3-hydroxypropyl)-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 115771713 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-ethyl-N-(3-hydroxypropyl)-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | CCN(CCCO)C(=O)Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H16N4O4/c1-2-12(5-3-7-15)10(16)8-13-6-4-9(11-13)14(17)18/h4,6,15H,2-3,5,7-8H2,1H3 |
| InChIKey | CLCMJYOPQKYJGI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|