C10H14N4O5 — CID 47415830
ethyl 2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]propanoate (PubChem CID 47415830) has the molecular formula C10H14N4O5 and a molecular weight of 270.25 g/mol. Its IUPAC name is ethyl 2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 47415830 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethyl 2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H14N4O5/c1-3-19-10(16)7(2)11-9(15)6-13-5-4-8(12-13)14(17)18/h4-5,7H,3,6H2,1-2H3,(H,11,15) |
| InChIKey | BBACXSUCSCKJHW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|