C16H20N4O6 — CID 55847698
2-(3-nitropyrazol-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide (PubChem CID 55847698) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-(3-nitropyrazol-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3-nitropyrazol-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55847698 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-(3-nitropyrazol-1-yl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(C(C)NC(=O)Cn2ccc([N+](=O)[O-])n2)cc(OC)c1OC |
| InChI | InChI=1S/C16H20N4O6/c1-10(11-7-12(24-2)16(26-4)13(8-11)25-3)17-15(21)9-19-6-5-14(18-19)20(22)23/h5-8,10H,9H2,1-4H3,(H,17,21) |
| InChIKey | YKQPHGRGAOXAEL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|