C9H11N7O3 — CID 103725978
2-(3-nitropyrazol-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide (PubChem CID 103725978) has the molecular formula C9H11N7O3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-(3-nitropyrazol-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide.
| Compound Name | 2-(3-nitropyrazol-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103725978 |
| Molecular Formula | C9H11N7O3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-(3-nitropyrazol-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cn1ccc([N+](=O)[O-])n1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H11N7O3/c1-6(9-10-5-11-13-9)12-8(17)4-15-3-2-7(14-15)16(18)19/h2-3,5-6H,4H2,1H3,(H,12,17)(H,10,11,13) |
| InChIKey | RRQFGGUFDPCVSW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|