C10H18ClN5O3 — CID 120652830
N-[(2R)-2-(ethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide;hydrochloride (PubChem CID 120652830) has the molecular formula C10H18ClN5O3 and a molecular weight of 291.74 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120652830 |
| Molecular Formula | C10H18ClN5O3 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-(3-nitropyrazol-1-yl)acetamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)Cn1ccc([N+](=O)[O-])n1.Cl |
| InChI | InChI=1S/C10H17N5O3.ClH/c1-3-11-8(2)6-12-10(16)7-14-5-4-9(13-14)15(17)18;/h4-5,8,11H,3,6-7H2,1-2H3,(H,12,16);1H/t8-;/m1./s1 |
| InChIKey | RPCCAUXXZJGLDL-DDWIOCJRSA-N |
| XLogP | 0.33 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|