C10H12N4O7 — CID 62112095
2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pentanedioic acid (PubChem CID 62112095) has the molecular formula C10H12N4O7 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 62112095 |
| Molecular Formula | C10H12N4O7 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)Cn1ccc([N+](=O)[O-])n1)C(=O)O |
| InChI | InChI=1S/C10H12N4O7/c15-8(5-13-4-3-7(12-13)14(20)21)11-6(10(18)19)1-2-9(16)17/h3-4,6H,1-2,5H2,(H,11,15)(H,16,17)(H,18,19) |
| InChIKey | XQUYMFSAXZMJET-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 164.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|