C15H16N4O6S — CID 2235627
ethyl 5-acetyl-4-methyl-2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 2235627) has the molecular formula C15H16N4O6S and a molecular weight of 380.38 g/mol. Its IUPAC name is ethyl 5-acetyl-4-methyl-2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-4-methyl-2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2235627 |
| Molecular Formula | C15H16N4O6S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | ethyl 5-acetyl-4-methyl-2-[[2-(3-nitropyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Cn2ccc([N+](=O)[O-])n2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C15H16N4O6S/c1-4-25-15(22)12-8(2)13(9(3)20)26-14(12)16-11(21)7-18-6-5-10(17-18)19(23)24/h5-6H,4,7H2,1-3H3,(H,16,21) |
| InChIKey | WNRQQMYHIRXDST-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|