C15H16IN3O4S — CID 5304724
ethyl 5-acetyl-2-[[2-(4-iodopyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 5304724) has the molecular formula C15H16IN3O4S and a molecular weight of 461.28 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[[2-(4-iodopyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[[2-(4-iodopyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5304724 |
| Molecular Formula | C15H16IN3O4S |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | ethyl 5-acetyl-2-[[2-(4-iodopyrazol-1-yl)acetyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Cn2cc(I)cn2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C15H16IN3O4S/c1-4-23-15(22)12-8(2)13(9(3)20)24-14(12)18-11(21)7-19-6-10(16)5-17-19/h5-6H,4,7H2,1-3H3,(H,18,21) |
| InChIKey | AYOGOGSYBMPGDL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|